PRODUCT Properties
| Melting point: | 48°C |
| Boiling point: | 241.8±20.0 °C(Predicted) |
| Density | 1.494±0.06 g/cm3(Predicted) |
| Flash point: | >110℃ |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Light yellow to Green |
| InChI | InChI=1S/C6H3ClFNO2/c7-4-1-2-6(9(10)11)5(8)3-4/h1-3H |
| InChIKey | PTCPUGKKWNMITF-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=CC=C(Cl)C=C1F |
| CAS DataBase Reference | 700-37-8(CAS DataBase Reference) |
Description and Uses
4-chloro-2-fluoronitrobenzene is a vital farming intermediate approximately, such as synthetic low toxicity, broad spectrum, ultra-high efficiency weedicide fluthiacetmethyl. The existing synthetic method has a great majority of 2, and 4-dichloronitrobenzene is a starting raw material, so prepare 4-chloro-2-fluoronitrobenzene through the halogen replacement(metathesis)reaction.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38-22 |
| Safety Statements | 26-36/37/39-37 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 29042090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






