A2411112
3-Chloro-4-fluorobenzaldehyde , 97% , 34328-61-5
CAS NO.：34328-61-5
Empirical Formula: C7H4ClFO
Molecular Weight: 158.56
MDL number: MFCD00011735
EINECS: 608-972-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB103.20 | In Stock |
|
| 100G | RMB399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 28-30 °C (lit.) |
| Boiling point: | 66 °C |
| Density | 1.3310 (estimate) |
| refractive index | 1.544-1.546 |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | Liquid After Melting |
| color | Clear light yellow |
| FreezingPoint | 22.0 to 25.0 ℃ |
| Sensitive | Air Sensitive |
| BRN | 1857885 |
| InChI | InChI=1S/C7H4ClFO/c8-6-3-5(4-10)1-2-7(6)9/h1-4H |
| InChIKey | GVORVQPNNSASDM-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(F)C(Cl)=C1 |
| CAS DataBase Reference | 34328-61-5(CAS DataBase Reference) |
Description and Uses
3-Chloro-4-fluorobenzaldehyde was used in synthesis of triclosan analogs bearing isoxazole group on ring.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-28-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29130000 |
