A8401512
4-Chloro-2,5-difluorobenzoic acid , 98% , 132794-07-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB86.40 | In Stock |
|
| 25G | RMB287.20 | In Stock |
|
| 100g | RMB999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 154-157 °C (lit.) |
| Boiling point: | 258°C (rough estimate) |
| Density | 1.4821 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 2.70±0.10(Predicted) |
| form | Crystalline Powder |
| color | Off-white |
| InChI | InChI=1S/C7H3ClF2O2/c8-4-2-5(9)3(7(11)12)1-6(4)10/h1-2H,(H,11,12) |
| InChIKey | PEPCYJSDHYMIFN-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(F)=C(Cl)C=C1F |
| CAS DataBase Reference | 132794-07-1(CAS DataBase Reference) |
Description and Uses
4-Chloro-2,5-difluorobenzoic acid reacts with substituted 2-hydroxy acetophenones in the presence of POCl3 to afford 2-acetylphenyl-4-chloro-2,5-difluorobenzoate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






