A3259312
2,5-Difluorobenzoic acid , 98% , 2991-28-8
CAS NO.:2991-28-8
Empirical Formula: C7H4F2O2
Molecular Weight: 158.1
MDL number: MFCD00002410
EINECS: 221-060-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB96.80 | In Stock |
|
| 100G | RMB377.60 | In Stock |
|
| 500g | RMB1864.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132-134 °C (lit.) |
| Boiling point: | 244.7±20.0 °C(Predicted) |
| Density | 1.3486 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | acetone: soluble25mg/mL, clear, faintly yellow |
| pka | 2.93±0.10(Predicted) |
| form | Solid |
| color | White |
| Water Solubility | Insoluble in water. |
| BRN | 973351 |
| InChI | InChI=1S/C7H4F2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11) |
| InChIKey | LBQMIAVIGLLBGW-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(F)=CC=C1F |
| CAS DataBase Reference | 2991-28-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,5-Difluorobenzoic acid(2991-28-8) |
| EPA Substance Registry System | Benzoic acid, 2,5-difluoro- (2991-28-8) |
Description and Uses
2,5-Difluorobenzoic acid is used in the preparation of hydrazone derivatives, which acts as a potential antibacterial agent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280g-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





