A2411812
2-Chloro-1,3-difluorobenzene , 98% , 38361-37-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB96.00 | In Stock |
|
| 25G | RMB360.00 | In Stock |
|
| 100G | RMB1072.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 126-128 |
| Density | 1.37 |
| refractive index | 1.4780-1.4820 |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C6H3ClF2/c7-6-4(8)2-1-3-5(6)9/h1-3H |
| InChIKey | OTZQYBFTOANOJO-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC(F)=C1Cl |
| CAS DataBase Reference | 38361-37-4(CAS DataBase Reference) |
Description and Uses
2-Chloro-1,3-difluorobenzene is a colorless to pale yellow liquid and a valuable trihalogenated benzene derivative.
Safety
| Symbol(GHS) |  GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210-P233-P240-P241+P242+P243-P280-P303+P361+P353-P403+P235-P501 |
| Hazard Codes | F |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | 1993 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 2903998090 |
