A2413012
4-Chloro-3-nitrocinnamic acid , 98% , 20797-48-2
CAS NO.:20797-48-2
Empirical Formula: C9H6ClNO4
Molecular Weight: 227.6
MDL number: MFCD00063311
EINECS: 200-680-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB243.20 | In Stock |
|
| 25G | RMB679.20 | In Stock |
|
| 100G | RMB2734.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-190 °C(lit.) |
| Boiling point: | 408.6±35.0 °C(Predicted) |
| Density | 1.4751 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Storage temp. 2-8°C |
| pka | 4.03±0.10(Predicted) |
| form | powder to crystal |
| color | Light yellow to Brown |
| InChI | InChI=1S/C9H6ClNO4/c10-7-3-1-6(2-4-9(12)13)5-8(7)11(14)15/h1-5H,(H,12,13) |
| InChIKey | QBDALTIMHOITIU-DUXPYHPUSA-N |
| SMILES | C(O)(=O)C=CC1=CC=C(Cl)C([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 20797-48-2(CAS DataBase Reference) |
Description and Uses
trans-4-Chloro-3-nitrocinnamic acid may be used in chemical synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29163990 |





