A2413612
Coumarin-6-sulfonyl chloride , 97% , 10543-42-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB71.20 | In Stock |
|
| 1G | RMB215.20 | In Stock |
|
| 5G | RMB902.40 | In Stock |
|
| 25G | RMB3598.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110-113 |
| Boiling point: | 431.6±40.0 °C(Predicted) |
| Density | 1.591±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | crystalline powder |
| color | White |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C9H5ClO4S/c10-15(12,13)7-2-3-8-6(5-7)1-4-9(11)14-8/h1-5H |
| InChIKey | HQIPMBGUDSOVEA-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC=C(S(Cl)(=O)=O)C=C2C=C1 |
| CAS DataBase Reference | 10543-42-7(CAS DataBase Reference) |
Description and Uses
Coumarin-6-sulfonyl chloride is used as a derivatizing agent for amines and phenols.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| HS Code | 2932209090 |
