A2415112
2-Chloro-4-fluorobenzoic Acid , 99% , 2252-51-9
CAS NO.:2252-51-9
Empirical Formula: C7H4ClFO2
Molecular Weight: 174.56
MDL number: MFCD00010615
EINECS: 218-845-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB72.80 | In Stock |
|
| 100G | RMB236.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 181-183 °C (lit.) |
| Boiling point: | 271.9±20.0 °C(Predicted) |
| Density | 1.4016 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 95% ethanol: soluble50mg/mL, clear to very slightly hazy, colorless to very faintly yellow |
| form | Powder or Flakes |
| pka | 2.90±0.25(Predicted) |
| color | White |
| BRN | 1946215 |
| InChI | InChI=1S/C7H4ClFO2/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3H,(H,10,11) |
| InChIKey | GRPWQLDSGNZEQE-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(F)C=C1Cl |
| CAS DataBase Reference | 2252-51-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Chloro-4-fluorobenzoic acid(2252-51-9) |
| EPA Substance Registry System | Benzoic acid, 2-chloro-4-fluoro- (2252-51-9) |
Description and Uses
2-Chloro-4-fluorobenzoic acid was used in the preparation of 2-(2-chloro-4-fluorophenyl)-benzothiazole.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-37/38-41-36/37/38 |
| Safety Statements | 26-36/37/39-37/39-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |





