A2416012
4-Chloro-3-fluorotoluene , 98% , 5527-94-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB82.08 | In Stock |
|
| 10g | RMB101.60 | In Stock |
|
| 25g | RMB180.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 157-158°C |
| Density | 1,2 g/cm3 |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| color | Clear, colourless |
| InChI | InChI=1S/C7H6ClF/c1-5-2-3-6(8)7(9)4-5/h2-4H,1H3 |
| InChIKey | MHXNHUSVBYUTJL-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C(C)C=C1F |
| CAS DataBase Reference | 5527-94-6(CAS DataBase Reference) |
Description and Uses
Used as solvents and as intermediates for making other chemicals and dyes.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P261-P280h-P305+P351+P338 |
| Hazard Codes | Xi,F |
| Risk Statements | 36/37/38-10 |
| Safety Statements | 26-36/37/39-36-16 |
| RIDADR | 3265 |
| Hazard Note | Irritant/Flammable |
| HazardClass | 3 |
| HS Code | 2903998090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







