A2420312
1-Cbz-4-piperidinecarboxylic Acid , 97% , 10314-98-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB53.60 | In Stock |
|
| 25G | RMB121.60 | In Stock |
|
| 100G | RMB424.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78 °C |
| Boiling point: | 443.9±45.0 °C(Predicted) |
| Density | 1.265±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.55±0.20(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C14H17NO4/c16-13(17)12-6-8-15(9-7-12)14(18)19-10-11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H,16,17) |
| InChIKey | URTPNQRAHXRPMP-UHFFFAOYSA-N |
| SMILES | N1(C(OCC2=CC=CC=C2)=O)CCC(C(O)=O)CC1 |
| CAS DataBase Reference | 10314-98-4(CAS DataBase Reference) |
Description and Uses
1-[(Benzyloxy)carbonyl]piperidine-4-carboxylic acid serves as a precursor for synthesizing benzyl 4-{[(2-cyano-4,5-dimethoxyphenyl)amino]carbonyl}piperidine-1-carboxylate via reaction with 2-amino-4,5-dimethoxybenzonitrile, where the acid is first treated with oxalyl chloride and DMF in dichloromethane to form an intermediate[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36 |
| Safety Statements | 26-36/37/39-37/39 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |






