A2421612
4-Chloro-3-nitrotoluene , 97% , 89-60-1
CAS NO.:89-60-1
Empirical Formula: C7H6ClNO2
Molecular Weight: 171.58
MDL number: MFCD00007085
EINECS: 201-922-8
| Pack Size | Price | Stock | Quantity |
| 25G | RMB52.00 | In Stock |
|
| 100G | RMB196.00 | In Stock |
|
| 500G | RMB818.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 7 °C(lit.) |
| Boiling point: | 260 °C745 mm Hg(lit.) |
| Density | 1.297 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Light yellow to Yellow to Orange |
| BRN | 511055 |
| InChI | 1S/C7H6ClNO2/c1-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3 |
| InChIKey | NWESJZZPAJGHRZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Cl)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 89-60-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-chloro-4-methyl-2-nitro-(89-60-1) |
| EPA Substance Registry System | Benzene, 1-chloro-4-methyl-2-nitro- (89-60-1) |
Description and Uses
4-Chloro-3-nitrotoluene was used in the synthesis of 4-(2-hydroxyethylamino)-3-nitrotoluene.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H411 |
| Precautionary statements | P273-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,N |
| Risk Statements | 22-36/37/38-20/21/22-52/53-51/53-36/38-33 |
| Safety Statements | 36/37/39-26-61-57-36/37-23-9 |
| RIDADR | UN 2433 6.1/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049085 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





