A2423212
4-Chlorophenethyl alcohol , 98% , 1875-88-3
CAS NO.:1875-88-3
Empirical Formula: C8H9ClO
Molecular Weight: 156.61
MDL number: MFCD00002899
EINECS: 217-506-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 10G | RMB54.40 | In Stock |
|
| 25G | RMB67.20 | In Stock |
|
| 50G | RMB219.20 | In Stock |
|
| 100G | RMB221.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 110 °C/0.5 mmHg (lit.) |
| Density | 1.157 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| pka | 14.79±0.10(Predicted) |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C8H9ClO/c9-8-3-1-7(2-4-8)5-6-10/h1-4,10H,5-6H2 |
| InChIKey | HZFRKZWBVUJYDA-UHFFFAOYSA-N |
| SMILES | C1(CCO)=CC=C(Cl)C=C1 |
| CAS DataBase Reference | 1875-88-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Chlorophenyl methyl carbinol(1875-88-3) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29062990 |
| Storage Class | 10 - Combustible liquids |





