A2428512
3-Chloro-6-methylpyridazine , 98% , 1121-79-5
CAS NO.:1121-79-5
Empirical Formula: C5H5ClN2
Molecular Weight: 128.56
MDL number: MFCD00052905
EINECS: 627-952-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB85.60 | In Stock |
|
| 25G | RMB182.40 | In Stock |
|
| 100G | RMB1400.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 58-62 °C |
| Boiling point: | 58 °C |
| Density | 1.234±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO, Methanol (Slightly) |
| form | Solid |
| pka | 1.26±0.10(Predicted) |
| color | Pale Beige |
| BRN | 108655 |
| InChI | InChI=1S/C5H5ClN2/c1-4-2-3-5(6)8-7-4/h2-3H,1H3 |
| InChIKey | PRORLQAJNJMGAR-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NN=C(C)C=C1 |
| CAS DataBase Reference | 1121-79-5(CAS DataBase Reference) |
Description and Uses
3-Chloro-6-methylpyridazine is used for preparation of heterocyclic compounds as integrase inhibiting antiviral agents.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H317-H318 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-43-41-38-22 |
| Safety Statements | 26-37/39-36/37-37 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1 |






