PRODUCT Properties
| Melting point: | 114.0 to 118.0 °C |
| Density | 1.51±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 3.68±0.30(Predicted) |
| color | White to Gray to Brown |
| InChI | InChI=1S/C6H4ClN3/c7-5-1-2-6-8-3-4-10(6)9-5/h1-4H |
| InChIKey | MPZDNIJHHXRTIQ-UHFFFAOYSA-N |
| SMILES | C12=NC=CN1N=C(Cl)C=C2 |
| CAS DataBase Reference | 6775-78-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 2933599590 |

![6-Chloroimidazo[1,2-b]pyridazine](https://img.chemicalbook.com/CAS/GIF/6775-78-6.gif)

![Ethyl 6-chloroimidazo[1,2-b]pyridazine-2-carboxylate](https://img.chemicalbook.com/CAS/GIF/64067-99-8.gif)


