A2428912
Coumachlor , 98% , 81-82-3
Synonym(s):
(±)-3-(α-Acetonyl-p-chlorobenzyl)-4-hydroxycoumarin;p-Chlorowarfarin
CAS NO.：81-82-3
Empirical Formula: C19H15ClO4
Molecular Weight: 342.77
MDL number: MFCD00012094
EINECS: 201-378-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB791.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168-170 °C (lit.) |
| Boiling point: | 543.1±50.0 °C(Predicted) |
| Density | 1.2972 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | acetone: soluble |
| pka | 4.50±1.00(Predicted) |
| form | powder |
| color | light yellow |
| Merck | 13,2581 |
| BRN | 6819431 |
| InChI | 1S/C19H15ClO4/c1-11(21)10-15(12-6-8-13(20)9-7-12)17-18(22)14-4-2-3-5-16(14)24-19(17)23/h2-9,15,22H,10H2,1H3 |
| InChIKey | DEKWZWCFHUABHE-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(c1ccc(Cl)cc1)C2=C(O)c3ccccc3OC2=O |
| CAS DataBase Reference | 81-82-3(CAS DataBase Reference) |
| EPA Substance Registry System | Coumachlor (81-82-3) |
Description and Uses
Coumachlor was used as internal standard for simultaneous enantioseparation of (+/-)-warfarin by chiral capillary electrochromatography with electrospray ionization mass spectrometry.
Safety
| Symbol(GHS) |   GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H310-H373-H412 |
| Precautionary statements | P262-P273-P280-P301+P310-P302+P352+P310-P314 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 48/22-52/53 |
| Safety Statements | 37-61 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 2 |
| RTECS | GN4830000 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 3 Oral Aquatic Chronic 3 STOT RE 2 |
| Hazardous Substances Data | 81-82-3(Hazardous Substances Data) |
| Toxicity | MLD in dog, swine (mg/kg): <5, <5 orally (Wanntorp) |
