PRODUCT Properties
| Melting point: | 34-38℃ |
| Boiling point: | 190°C |
| Density | 1.408±0.06 g/cm3(Predicted) |
| Flash point: | 190°C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | fused solid |
| pka | 7.74±0.10(Predicted) |
| color | Pale yellow |
| Water Solubility | Insoluble in water. |
| InChI | InChI=1S/C6H4ClFO/c7-4-2-1-3-5(9)6(4)8/h1-3,9H |
| InChIKey | PCHPYNHSMSAJEU-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=CC(Cl)=C1F |
| CAS DataBase Reference | 2613-22-1(CAS DataBase Reference) |
Description and Uses
3-Chloro-2-fluorophenol are employed in the preparation of resins, dyes, explosives, lubricants, and plastics. Also they are are endowed with antioxidant property and are used as antioxidants in many formulations such as pharmaceuticals, cosmetics, electrical transformer oil, solvents, and organic reactions.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H312-H314-H318-H401-H411 |
| Precautionary statements | P273-P280-P303+P361+P353-P305+P351+P338-P310 |
| Hazard Codes | T,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | WGK 3 |
| Hazard Note | Toxic |
| HazardClass | IRRITANT, IRRITANT-HARMFUL |
| HazardClass | 8 |
| HS Code | 2908190090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 |








