A2431712
5-Chloro-2-nitroanisole , 97% , 6627-53-8
CAS NO.:6627-53-8
Empirical Formula: C7H6ClNO3
Molecular Weight: 187.58
MDL number: MFCD00007288
EINECS: 229-594-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB48.00 | In Stock |
|
| 5G | RMB120.80 | In Stock |
|
| 25G | RMB401.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70-72 °C(lit.) |
| Boiling point: | 289.1±20.0 °C(Predicted) |
| Density | 1.4219 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Ethyl Acetate |
| form | Solid |
| color | Yellow |
| InChI | InChI=1S/C7H6ClNO3/c1-12-7-4-5(8)2-3-6(7)9(10)11/h2-4H,1H3 |
| InChIKey | ABEUJUYEUCCZQF-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=CC=C(Cl)C=C1OC |
| CAS DataBase Reference | 6627-53-8(CAS DataBase Reference) |
| EPA Substance Registry System | 5-Chloro-2-nitroanisole (6627-53-8) |
Description and Uses
5-Chloro-2-nitroanisole is involved in the synthesis of orally bioavailable anaplastic lymphoma kinases (ALK) inhibitors as anticancer drugs (1). In addition, it is used in the synthesis of kinesin spindle protein (KSP) inhibitors which are responsible for the spindle pole separation which occurs during mitosis in cancer cells (2).
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H350i |
| Precautionary statements | P202-P264-P270-P280-P301+P312-P308+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| HS Code | 2909309090 |







