A2432112
1-Chloro-3,5-difluorobenzene , 97% , 1435-43-4
CAS NO.:1435-43-4
Empirical Formula: C6H3ClF2
Molecular Weight: 148.54
MDL number: MFCD00041518
EINECS: 627-820-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB112.80 | In Stock |
|
| 100G | RMB417.60 | In Stock |
|
| 500g | RMB1849.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 111-112 °C (lit.) |
| Density | 1.329 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 85 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| BRN | 2205670 |
| InChI | InChI=1S/C6H3ClF2/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| InChIKey | RFKBODCWHNDUTJ-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC(F)=CC(F)=C1 |
| CAS DataBase Reference | 1435-43-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H226 |
| Precautionary statements | P210-P233-P240-P241+P242+P243-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P403+P235-P501-P261-P280g-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,F |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 37/39-26-16 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 2 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




