A2433512
2-Chloro-4-(trifluoromethyl)benzonitrile , 97% , 1813-33-8
Synonym(s):
3-Chloro-4-cyanobenzotrifluoride
| Pack Size | Price | Stock | Quantity |
| 1G | RMB26.40 | In Stock |
|
| 5G | RMB95.20 | In Stock |
|
| 25G | RMB383.20 | In Stock |
|
| 100G | RMB1359.20 | In Stock |
|
| 500g | RMB6399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 82-83°C/8mm |
| Boiling point: | 192-193 °C(lit.) |
| Density | 1.389 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >220 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | fused solid |
| color | White |
| InChI | InChI=1S/C8H3ClF3N/c9-7-3-6(8(10,11)12)2-1-5(7)4-13/h1-3H |
| InChIKey | GEHMLBFNZKJDQM-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(C(F)(F)F)C=C1Cl |
| CAS DataBase Reference | 1813-33-8(CAS DataBase Reference) |
Description and Uses
2-Chloro-4-trifluoromethylbenzonitrile (cas# 1813-33-8) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H315-H319-H302-H311-H332 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P310+P330-P302+P352+P312+P361+P364-P304+P340+P311-P305+P351+P338+P337+P313-P403+P233-P405-P501-P280h-P305+P351+P338-P309-P310 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39-36 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2926907090 |
| Storage Class | 10 - Combustible liquids |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








