BD7647031
2-Chloro-4-(trifuloromethyl)phenol , 98% , 35852-58-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB84.00 | In Stock |
|
| 25g | RMB302.40 | In Stock |
|
| 100g | RMB1018.40 | In Stock |
|
| 500g | RMB3818.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 66°C/13mmHg(lit.) |
| Density | 1.474±0.06 g/cm3(Predicted) |
| refractive index | 1.4740 to 1.4780 |
| Flash point: | 68°C(lit.) |
| storage temp. | 2-8°C |
| form | clear liquid |
| pka | 7.09±0.18(Predicted) |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C7H4ClF3O/c8-5-3-4(7(9,10)11)1-2-6(5)12/h1-3,12H |
| InChIKey | YNWKEXMSQQUMEL-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(C(F)(F)F)C=C1Cl |
| CAS DataBase Reference | 35852-58-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P271-P280 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 2933499090 |






