A2434012
3-Chloro-2-fluorobenzyl bromide , 96% , 85070-47-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB84.00 | In Stock |
|
| 25G | RMB342.40 | In Stock |
|
| 100g | RMB1119.20 | In Stock |
|
| 500g | RMB5039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <35°C |
| Boiling point: | 126 °C |
| Density | 1.654±0.06 g/cm3(Predicted) |
| refractive index | 1.569 |
| Flash point: | 125-126°C/15mm |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform, DMSO, Methanol |
| form | Solid |
| color | Pale Yellow |
| FreezingPoint | 27.0 to 32.0 ℃ |
| Sensitive | Lachrymatory |
| InChI | InChI=1S/C7H5BrClF/c8-4-5-2-1-3-6(9)7(5)10/h1-3H,4H2 |
| InChIKey | AQQPRCFCKCXWGZ-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=CC(Cl)=C1F |
| CAS DataBase Reference | 85070-47-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Chloro-2-fluorobenzyl bromide(85070-47-9) |
Description and Uses
3-Chloro-2-fluorobenzyl Bromide (cas# 85070-47-9) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |    GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H290-H314-H335-H341-H318 |
| Precautionary statements | P305+P351+P338-P309-P310-P201-P202-P234-P260-P264-P271-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P308+P313-P390-P403+P233-P405-P406-P501 |
| Hazard Codes | C,Xn |
| Risk Statements | 34-36/37/38-52-22 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3265 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29039990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
