A3630012
3,4-Dichlorobenzyl chloride , 97% , 102-47-6
Synonym(s):
α,3,4-Trichlorotoluene
CAS NO.:102-47-6
Empirical Formula: C7H5Cl3
Molecular Weight: 195.47
MDL number: MFCD00000906
EINECS: 203-033-0
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -3 °C |
| Boiling point: | 122-124 °C14 mm Hg(lit.) |
| Density | 1.411 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 155 °C |
| storage temp. | Store below +30°C. |
| solubility | Chloroform, Methanol (Slightly) |
| form | Liquid |
| Specific Gravity | 1.409 |
| color | Clear colorless to very slightly yellow |
| BRN | 386644 |
| InChI | InChI=1S/C7H5Cl3/c8-4-5-1-2-6(9)7(10)3-5/h1-3H,4H2 |
| InChIKey | YZIFVWOCPGPNHB-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C(CCl)C=C1Cl |
| CAS DataBase Reference | 102-47-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,2-dichloro-4-(chloromethyl)-(102-47-6) |
| EPA Substance Registry System | Benzene, 1,2-dichloro-4-(chloromethyl)- (102-47-6) |
Description and Uses
3,4-Dichlorobenzyl chloride has been used:
- in Friedel-Crafts synthesis of 4-(3,4-dichlorophenyl)-3,4-dihydro-1(2H)-naphthalenone, a key intermediate for the synthesis of sertraline
- as alkylating agent in synthesis of poly(ether ketone)s having pendant sulfonic acid groups
- in preparation of 5,6-dichloro-2-(3,4-dichlorobenzylthio)benzimidazole
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P261-P271-P280-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34-36/37 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 19 |
| Hazard Note | Corrosive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29036990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







