![5-Chloro-1H-pyrrolo[2,3-b]pyridine](https://img.chemicalbook.com/CAS/GIF/866546-07-8.gif)
A2435412
5-Chloro-1H-pyrrolo[2,3-b]pyridine , 98% , 866546-07-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB74.40 | In Stock |
|
| 5G | RMB243.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 161-162°C |
| Density | 1.425±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 12.97±0.40(Predicted) |
| form | Powder |
| color | White to pale brown |
| InChI | InChI=1S/C7H5ClN2/c8-6-3-5-1-2-9-7(5)10-4-6/h1-4H,(H,9,10) |
| InChIKey | MFZQJIKENSPRSJ-UHFFFAOYSA-N |
| SMILES | C12NC=CC1=CC(Cl)=CN=2 |
Description and Uses
5-Chloro-7-azaindole can be used as an organic synthesis intermediate and a pharmaceutical intermediate, and is mainly used in laboratory research and development processes and chemical and pharmaceutical production processes.
Safety
| Symbol(GHS) |   GHS07,GHS05 |
| Signal word | Warning |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22 |
| Safety Statements | 24/25 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
