A2435712
5-Cyano-7-azaindole , 97% , 517918-95-5
CAS NO.:517918-95-5
Empirical Formula: C8H5N3
Molecular Weight: 143.15
MDL number: MFCD06659684
EINECS: 1806241-263-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB111.20 | In Stock |
|
| 1G | RMB231.20 | In Stock |
|
| 5G | RMB767.20 | In Stock |
|
| 25g | RMB3071.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 225.1-225.2°C |
| Density | 1.33±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| pka | 12.50±0.40(Predicted) |
| Appearance | Off-white to light brown Solid |
| InChI | InChI=1S/C8H5N3/c9-4-6-3-7-1-2-10-8(7)11-5-6/h1-3,5H,(H,10,11) |
| InChIKey | DRAQIXNADYAISI-UHFFFAOYSA-N |
| SMILES | C12NC=CC1=CC(C#N)=CN=2 |
Description and Uses
5-Cyano-7-azaindole is a commonly used intermediate in the synthesis of new anti-tumor drug protease inhibitors, mainly used in laboratory research and development processes and chemical production processes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280h-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |



![4-Chloro-1H-pyrrolo[2,3-b]pyridine-5-carbonitrile](https://img.chemicalbook.com/CAS/GIF/920966-02-5.gif)
![METHYL 5-CYANO-1H-PYRROLO[2,3-B]PYRIDINE-2-CARBOXYLATE](https://img.chemicalbook.com/CAS/GIF/952182-16-0.gif)
![3-iodo-1H-pyrrolo[3,2-e]pyridine-5-carbonitrile](https://img.chemicalbook.com/CAS/GIF/757978-11-3.gif)
![6-Methyl-1H-pyrrolo[2,3-b]pyridine-5-carbonitrile](https://img.chemicalbook.com/CAS/GIF/1000340-86-2.gif)