A2436912
(S)-(-)-4-Chloromethyl-2,2-dimethyl-1,3-dioxolane , 98% , 60456-22-6
CAS NO.:60456-22-6
Empirical Formula: C6H11ClO2
Molecular Weight: 150.6
MDL number: MFCD00273365
EINECS: 628-358-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB31.20 | In Stock |
|
| 1G | RMB45.60 | In Stock |
|
| 5G | RMB148.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | -42 º (neat 24 ºC) |
| Boiling point: | 63 °C37 mm Hg(lit.) |
| Density | 1.103 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 123 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | soluble in Chloroform, Ethyl Acetate |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.103 |
| BRN | 7409638 |
| InChI | InChI=1S/C6H11ClO2/c1-6(2)8-4-5(3-7)9-6/h5H,3-4H2,1-2H3/t5-/m1/s1 |
| InChIKey | BNPOTXLWPZOESZ-RXMQYKEDSA-N |
| SMILES | O1C[C@@H](CCl)OC1(C)C |
| CAS DataBase Reference | 60456-22-6(CAS DataBase Reference) |
Description and Uses
(S)-(-)-4-Chloromethyl-2,2-dimethyl-1,3-dioxolane is a colorless transparent liquid at room temperature and pressure. It is sensitive to acidic substances and is prone to decomposition reactions when encountering acidic substances. The chlorine atoms in its structure can undergo nucleophilic substitution reactions under the attack of organic amines and phenolic substances. This compound is an impurity of landiolol and is used for new drug research and experimental use.
(S)-4-Chloromethyl-2,2-dimethyl-1,3-dioxolane is often used in biosynthetic preparations.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H226-H301-H318 |
| Precautionary statements | P210-P280-P301+P310+P330-P305+P351+P338+P310 |
| Hazard Codes | Xi,T |
| Risk Statements | 10-41-36/37/38-25 |
| Safety Statements | 16-26-36-45-37/39-36/39 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| RTECS | JH6950000 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29329990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







