A2437612
3-Cyano-4,6-dimethyl-2-hydroxypyridine , >98.0%(GC) , 769-28-8
Synonym(s):
3-Cyano-4,6-dimethyl-2-hydroxypyridine;4,6-Dimethyl-2-hydroxynicotinonitrile
CAS NO.：769-28-8
Empirical Formula: C8H8N2O
Molecular Weight: 148.16
MDL number: MFCD00039703
EINECS: 212-207-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB80.80 | In Stock |
|
| 100G | RMB234.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 285-287 °C (lit.) |
| Boiling point: | 268.75°C (rough estimate) |
| Density | 1.1828 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 9.06±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 130992 |
| InChI | InChI=1S/C8H8N2O/c1-5-3-6(2)10-8(11)7(5)4-9/h3H,1-2H3,(H,10,11) |
| InChIKey | OCYMJCILWYHKAU-UHFFFAOYSA-N |
| SMILES | C1(=O)NC(C)=CC(C)=C1C#N |
| CAS DataBase Reference | 769-28-8(CAS DataBase Reference) |
Safety
| Symbol(GHS) |   GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H302-H312-H315-H319-H332-H335-H301 |
| Precautionary statements | P264-P270-P271-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501-P261-P280-P305+P351+P338-P280a-P301+P310a-P405-P501a |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| RTECS | QT3046500 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
