A2502612
3-Cyano-4-methylpyridine , ≥98.0% , 5444-01-9
CAS NO.：5444-01-9
Empirical Formula: C7H6N2
Molecular Weight: 118.14
MDL number: MFCD00234272
EINECS: 611-143-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB92.00 | In Stock |
|
| 25G | RMB300.80 | In Stock |
|
| 100g | RMB1103.20 | In Stock |
|
| 500g | RMB5199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 41-44°C |
| Boiling point: | 108-111°C 20mm |
| Density | 1.08±0.1 g/cm3(Predicted) |
| Flash point: | 108-111°C/20mm |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| pka | 2.45±0.18(Predicted) |
| form | powder to crystal |
| color | White to Orange to Green |
| BRN | 112016 |
| InChI | InChI=1S/C7H6N2/c1-6-2-3-9-5-7(6)4-8/h2-3,5H,1H3 |
| InChIKey | XLAPHZHNODDMDD-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(C)=C1C#N |
| CAS DataBase Reference | 5444-01-9(CAS DataBase Reference) |
Description and Uses
3-Cyano-4-methylpyridine, is an intermediate for the synthesis of various pharmaceutical compounds, including inhibitors and anticancer agents. It can be used for the preparation of a series of azaindenoisoquinoline topoisomerase I I inhibitors and potential anticancer agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P280h-P305+P351+P338-P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38-36/38-22 |
| Safety Statements | 22-36/37/39-36-26-36/37 |
| RIDADR | 3439 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Limited Quantities | 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
