A2440412
(1S)-(-)-Camphanic chloride , 98% , 39637-74-6
Synonym(s):
(−)-Camphanoyl chloride;(1S)-3-Oxo-4,7,7-trimethyl-2-oxabicyclo[2.2.1]heptane-1-carbonyl chloride
CAS NO.:39637-74-6
Empirical Formula: C10H13ClO3
Molecular Weight: 216.66
MDL number: MFCD00135626
EINECS: 254-552-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB74.40 | In Stock |
|
| 5G | RMB215.20 | In Stock |
|
| 25G | RMB863.20 | In Stock |
|
| 100G | RMB3071.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 71-73 °C(lit.) |
| alpha | -18 º (c=2, CCl4) |
| Boiling point: | 310.92°C (rough estimate) |
| Density | 1.2072 (rough estimate) |
| refractive index | 1.5390 (estimate) |
| storage temp. | 2-8°C |
| solubility | soluble in Dichloromethane, Ether, Ethyl Acetate, Methanol |
| form | Powder |
| color | Yellow to orange-brown |
| optical activity | [α]23/D 18°, c = 2 in carbon tetrachloride |
| Water Solubility | decomposes |
| Sensitive | Moisture Sensitive |
| BRN | 3590860 |
| InChI | 1S/C10H13ClO3/c1-8(2)9(3)4-5-10(8,6(11)12)14-7(9)13/h4-5H2,1-3H3/t9-,10+/m0/s1 |
| InChIKey | PAXWODJTHKJQDZ-RGURZIINSA-N |
| SMILES | CC1(C)[C@@]2(C)CC[C@@]1(OC2=O)C(Cl)=O |
| CAS DataBase Reference | 39637-74-6(CAS DataBase Reference) |
Description and Uses
(1S)-(-)-Camphanic chloride is used as a resolving agent for alcohols as the diastereomeric esters by crystallization or chromatography and as a chiral derivatization reagent for determination of enantiomeric excess of alcohols and amines.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,Xi |
| Risk Statements | 34-29 |
| Safety Statements | 26-36/37/39-45-8-27 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29322090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






