PRODUCT Properties
| Melting point: | 171-173°C |
| Boiling point: | 318.1±22.0 °C(Predicted) |
| Density | 1.352±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 2.78±0.25(Predicted) |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C8H7ClO3/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4H,1H3,(H,10,11) |
| InChIKey | AQHFCRYZABKUEV-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(OC)=CC=C1Cl |
| CAS DataBase Reference | 6280-89-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| Hazard Note | Irritant |
| HS Code | 2918999090 |






