A2445912
3-Chloro-2-fluorobenzonitrile , >98.0%(GC) , 94087-40-8
CAS NO.：94087-40-8
Empirical Formula: C7H3ClFN
Molecular Weight: 155.56
MDL number: MFCD00042206
EINECS: 301-934-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB40.80 | In Stock |
|
| 5G | RMB102.24 | In Stock |
|
| 25G | RMB220.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 40-44 °C(lit.) |
| Boiling point: | 206.3±20.0 °C(Predicted) |
| Density | 1.33±0.1 g/cm3(Predicted) |
| Flash point: | 164 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to lump |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C7H3ClFN/c8-6-3-1-2-5(4-10)7(6)9/h1-3H |
| InChIKey | CHKLNKWJIDQKFV-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=CC(Cl)=C1F |
| CAS DataBase Reference | 94087-40-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzonitrile, 3-chloro-2-fluoro-(94087-40-8) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H312+H332 |
| Precautionary statements | P261-P271-P280-P302+P352+P312-P304+P340+P312-P362+P364 |
| Hazard Codes | Xn,T,Xi,N |
| Risk Statements | 20/21/22 |
| Safety Statements | 36/37 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | IRRITANT |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
