A2447212
Ciprofibrate , >98.0%(GC) , 52214-84-3
Synonym(s):
2-[p-(2,2-Dichlorocyclopropyl)phenoxy]-2-methylpropanoic acid
CAS NO.:52214-84-3
Empirical Formula: C13H14Cl2O3
Molecular Weight: 289.15
MDL number: MFCD00467135
EINECS: 257-744-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB54.40 | In Stock |
|
| 5G | RMB187.20 | In Stock |
|
| 25G | RMB758.40 | In Stock |
|
| 100g | RMB1294.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 114-116° |
| Boiling point: | 401.74°C (rough estimate) |
| Density | 1.2576 (rough estimate) |
| refractive index | 1.5209 (estimate) |
| storage temp. | 2-8°C |
| solubility | Practically insoluble in water, freely soluble in anhydrous ethanol, soluble in toluene. |
| pka | 3.31±0.10(Predicted) |
| form | Solid |
| color | White to Pale Beige |
| Merck | 14,2313 |
| InChI | InChI=1S/C13H14Cl2O3/c1-12(2,11(16)17)18-9-5-3-8(4-6-9)10-7-13(10,14)15/h3-6,10H,7H2,1-2H3,(H,16,17) |
| InChIKey | KPSRODZRAIWAKH-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(OC1=CC=C(C2CC2(Cl)Cl)C=C1)(C)C |
| CAS DataBase Reference | 52214-84-3(CAS DataBase Reference) |
| EPA Substance Registry System | Propanoic acid, 2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methyl- (52214-84-3) |
Description and Uses
Ciprofibrate is a potent, long-acting hypolipidemic agent related to clofibrate, bezafibrate and fenofibrate. It is effective in types IIa, IIb, IIX and IV hyperlipoproteinemias, and produces a beneficial elevation of the anti-atherogenic HDL.
antihyperlipidemic
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H350 |
| Precautionary statements | P201-P308+P313 |
| Hazard Codes | T |
| Risk Statements | 45 |
| Safety Statements | 53-22-36/37/39-45 |
| WGK Germany | 3 |
| RTECS | UF0880000 |
| HS Code | 29189900 |





