A2448412
4-Chloro-pyridine-2-carboxylic acid amide , 97% , 99586-65-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB82.40 | In Stock |
|
| 25G | RMB266.40 | In Stock |
|
| 100G | RMB914.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148-152 |
| Boiling point: | 298.1±25.0 °C(Predicted) |
| Density | 1.381±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 14.49±0.50(Predicted) |
| form | Solid |
| color | Off-white |
| λmax | 268nm(EtOH)(lit.) |
| InChI | InChI=1S/C6H5ClN2O/c7-4-1-2-9-5(3-4)6(8)10/h1-3H,(H2,8,10) |
| InChIKey | XIHHOUUTBZSYJH-UHFFFAOYSA-N |
| SMILES | C1(C(N)=O)=NC=CC(Cl)=C1 |
| CAS DataBase Reference | 99586-65-9(CAS DataBase Reference) |
Description and Uses
4-Chloropyridine-2-carboxamide, is a versatile building block used in synthesis of various chemical compounds.
