A2449112
3-Chloro-o-anisidine , 97% , 51114-68-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB54.40 | In Stock |
|
| 5G | RMB225.60 | In Stock |
|
| 10G | RMB439.20 | In Stock |
|
| 25G | RMB941.60 | In Stock |
|
| 100G | RMB2805.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 179-180℃ (Decomposition) |
| Boiling point: | 112-116℃ (10 Torr) |
| Density | 1.234±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | liquid |
| pka | 3.48±0.10(Predicted) |
| color | Clear, dark red to tan |
| InChI | InChI=1S/C7H8ClNO/c1-10-7-5(8)3-2-4-6(7)9/h2-4H,9H2,1H3 |
| InChIKey | VPZJHTWLWKFPQW-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=CC(Cl)=C1OC |
Description and Uses
3-Chloro-o-anisidine may be used in chemical synthesis studies.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2921420090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






