A2449412
4-Chloro-2-methyl-6-nitroaniline , 98% , 62790-50-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB75.20 | In Stock |
|
| 5G | RMB261.60 | In Stock |
|
| 25G | RMB1308.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-132 °C |
| Boiling point: | 328.7±37.0 °C(Predicted) |
| Density | 1.4800 (rough estimate) |
| refractive index | 1.5560 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | Crystals or Needles |
| pka | -1.18±0.25(Predicted) |
| color | Orange |
| InChI | InChI=1S/C7H7ClN2O2/c1-4-2-5(8)3-6(7(4)9)10(11)12/h2-3H,9H2,1H3 |
| InChIKey | QDSCDFKGUAONPC-UHFFFAOYSA-N |
| SMILES | C1(N)=C([N+]([O-])=O)C=C(Cl)C=C1C |
| CAS DataBase Reference | 62790-50-5(CAS DataBase Reference) |
Description and Uses
4-Chloro-2-methyl-6-nitroaniline is used as a pharmaceutical intermediate in pharmaceutical synthesis and scientific research.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Warning |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P280a-P301+P310a-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| RIDADR | 2811 |
| HazardClass | IRRITANT |
| HS Code | 29214200 |






