A2452012
2-Chloro-N-methylacetamide , 97% , 96-30-0
CAS NO.:96-30-0
Empirical Formula: C3H6ClNO
Molecular Weight: 107.54
MDL number: MFCD00018913
EINECS: 202-497-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB84.00 | In Stock |
|
| 100G | RMB308.00 | In Stock |
|
| 500g | RMB1071.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38-40°C |
| Boiling point: | 112-115°C 20mm |
| Density | 1.127±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 14.38±0.46(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C3H6ClNO/c1-5-3(6)2-4/h2H2,1H3,(H,5,6) |
| InChIKey | HOZLOOPIXHWKCI-UHFFFAOYSA-N |
| SMILES | C(NC)(=O)CCl |
| CAS DataBase Reference | 96-30-0(CAS DataBase Reference) |
| NIST Chemistry Reference | ClCON(CH3)2(96-30-0) |
Description and Uses
2-Chloro-N-methylacetamide is an intermediate used to prepare piperidinylamino pyrrolopyrimidines as selective Janus kinase inhibitors for the treatment of autoimmune diseases and organ transplant rejection.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P310-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Risk Statements | 36/37/38-43-22 |
| Safety Statements | 26-36/37/39-36/37-24 |
| WGK Germany | WGK 3 |
| RTECS | AB5775000 |
| HazardClass | IRRITANT |
| HS Code | 29241990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



