A2452812
2-Chloro-3',4'-dihydroxyacetophenone , ≥97.0% , 99-40-1
Synonym(s):
4-(Chloroacetyl)catechol
CAS NO.:99-40-1
Empirical Formula: C8H7ClO3
Molecular Weight: 186.59
MDL number: MFCD00002200
EINECS: 202-754-8
| Pack Size | Price | Stock | Quantity |
| 25G | RMB55.20 | In Stock |
|
| 100G | RMB159.20 | In Stock |
|
| 500G | RMB743.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 174-176 °C(lit.) |
| Boiling point: | 418.7±35.0 °C(Predicted) |
| Density | 1.444±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in DMSO, methanol. |
| pka | 7.59±0.20(Predicted) |
| form | powder |
| color | White to Pale Beige |
| BRN | 2092660 |
| InChI | InChI=1S/C8H7ClO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,10-11H,4H2 |
| InChIKey | LWTJEJCZJFZKEL-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(O)C(O)=C1)CCl |
| CAS DataBase Reference | 99-40-1(CAS DataBase Reference) |
Description and Uses
2-Chloro-3',4'-dihydroxyacetophenone is used as a styptic adrenobazone, quasi adrenaline drug gasp spirit of intermediates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| HS Code | 29252900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




