A2454112
7-Chloro-4-hydroxyquinoline , 95% , 86-99-7
CAS NO.：86-99-7
Empirical Formula: C9H6ClNO
Molecular Weight: 179.6
MDL number: MFCD00006778
EINECS: 201-715-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB79.20 | In Stock |
|
| 25G | RMB223.20 | In Stock |
|
| 100G | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 276-279 °C(lit.) |
| Boiling point: | 348.5±22.0 °C(Predicted) |
| Density | 1.412±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.86±0.40(Predicted) |
| Appearance | Off-white to light brown Solid |
| BRN | 125356 |
| InChI | InChI=1S/C9H6ClNO/c10-6-1-2-7-8(5-6)11-4-3-9(7)12/h1-5H,(H,11,12) |
| InChIKey | XMFXTXKSWIDMER-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=C(Cl)C=2)C(O)=CC=1 |
| CAS DataBase Reference | 86-99-7(CAS DataBase Reference) |
Description and Uses
7-Chloroquinolin-4-ol is a pharmaceutical and dye intermediate that can be used to synthesize the anti-cancer drug chloroquine phosphate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2933499090 |
