PRODUCT Properties
| Melting point: | 32-34 |
| Boiling point: | 274℃ |
| Density | 1.1499 g/cm3 (32.5 ºC) |
| refractive index | 1.5830 (estimate) |
| storage temp. | Room Temperature |
| solubility | Chloroform, DMSO (Sparingly), Methanol (Slightly) |
| color | White to Pale Yellow |
| Water Solubility | 7.8mg/L(25 ºC) |
| BRN | 1907934 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C12H9Cl/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H |
| InChIKey | LAXBNTIAOJWAOP-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=CC=C1Cl |
| CAS DataBase Reference | 2051-60-7(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Chlorobiphenyl (2051-60-7) |
Description and Uses
2-Chlorobiphenyl can be used to treat TP receptor antagonists.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H373-H410 |
| Precautionary statements | P260-P273-P314-P391-P501 |
| Hazard Codes | Xi,N |
| Risk Statements | 33-50/53 |
| Safety Statements | 35-60-61 |
| RIDADR | 3077 |
| WGK Germany | 3 |
| RTECS | DV2065000 |
| Hazard Note | Irritant |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 2903998090 |




![2'-chloro[1,1'-biphenyl]-2,5-diol](https://img.chemicalbook.com/CAS/GIF/117-71-5.gif)

