A2470212
Captopril , ≥98% , 62571-86-2
Synonym(s):
[2S]-1-[3-Mercapto-2-methylpropionyl]-L-proline, SQ-14225;N-[(S)-3-Mercapto-2-methylpropionyl]-L -proline;Captopril;Captopril - CAS 62571-86-2 - Calbiochem
CAS NO.:62571-86-2
Empirical Formula: C9H15NO3S
Molecular Weight: 217.29
MDL number: MFCD00168073
EINECS: 263-607-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB57.60 | In Stock |
|
| 5G | RMB117.60 | In Stock |
|
| 25G | RMB280.00 | In Stock |
|
| 100g | RMB610.40 | In Stock |
|
| 500g | RMB1528.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 104-108 °C (lit.) |
| Boiling point: | 427.0±40.0 °C(Predicted) |
| alpha | -129.5 º (c=1, EtOH) |
| Density | 1.2447 (rough estimate) |
| refractive index | -127.5 ° (C=1.7, EtOH) |
| storage temp. | room temp |
| solubility | H2O: 0.1 g/mL, very slightly hazy, colorless |
| form | Crystalline Powder |
| pka | 3.7, 9.8(at 25℃) |
| color | white to off-white |
| biological source | synthetic (organic) |
| optical activity | -112.8°(C=0.01g/ml ETOH) |
| Water Solubility | soluble |
| Merck | 14,1774 |
| BRN | 477887 |
| BCS Class | 3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C9H15NO3S/c1-6(5-14)8(11)10-4-2-3-7(10)9(12)13/h6-7,14H,2-5H2,1H3,(H,12,13)/t6-,7+/m1/s1 |
| InChIKey | FAKRSMQSSFJEIM-RQJHMYQMSA-N |
| SMILES | C[C@H](CS)C(=O)N1CCC[C@H]1C(O)=O |
| CAS DataBase Reference | 62571-86-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Captopril(62571-86-2) |
Description and Uses
Captopril is the most studied of the angiotensin-converting enzyme inhibitors proposed as an antihypertensive drug. It blocks angiotensin-converting enzyme, which suppresses formation of angiotensin II and relieves its vasoconstricting effect on arterial and venous vessels. Overall vascular peripheral tension is reduced, which results in the lowering of arterial pressure.
angiotensin-converting enzyme (ACE) inhibitor,anti-hypertensive
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H341-H360F |
| Precautionary statements | P201-P308+P313 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn,Xi |
| Risk Statements | 43-63-36/37/38-40 |
| Safety Statements | 36/37-37/39-26-36-22 |
| WGK Germany | 2 |
| RTECS | UY0550000 |
| HS Code | 29339900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Muta. 2 Repr. 1B |
| Hazardous Substances Data | 62571-86-2(Hazardous Substances Data) |
| Toxicity | LD50 in mice (mg/kg): 1040 i.v.; 6000 orally (Keim) |







