A2474112
Clofazimine , ≥98% , 2030-63-9
Synonym(s):
N,5-Bis(4-chlorophenyl)-3,5-dihydro-3-(isopropylimino)phenazin-2-amine
CAS NO.:2030-63-9
Empirical Formula: C27H22Cl2N4
Molecular Weight: 473.4
MDL number: MFCD00056793
EINECS: 217-980-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB96.00 | In Stock |
|
| 5G | RMB351.20 | In Stock |
|
| 25g | RMB1501.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210-212° |
| Boiling point: | 616.26°C (rough estimate) |
| Density | 1.1342 (rough estimate) |
| refractive index | 1.6300 (estimate) |
| storage temp. | 2-8°C |
| solubility | Practically insoluble in water, soluble in methylene chloride, very slightly soluble in ethanol (96 per cent). It shows polymorphism (5.9). |
| pka | 8.37; also reported as 8.51(at 25℃) |
| form | Solid |
| color | Yellow to Amber to Dark red |
| Water Solubility | 10mg/L(temperature not stated) |
| Merck | 14,2373 |
| BCS Class | 4/3 |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C27H22Cl2N4/c1-17(2)30-24-16-27-25(15-23(24)31-20-11-7-18(28)8-12-20)32-22-5-3-4-6-26(22)33(27)21-13-9-19(29)10-14-21/h3-17,31H,1-2H3 |
| InChIKey | WDQPAMHFFCXSNU-UHFFFAOYSA-N |
| SMILES | C1C2C(N(C3=CC=C(Cl)C=C3)C3=C(N=2)C=CC=C3)=CC(=NC(C)C)C=1NC1=CC=C(Cl)C=C1 |
Description and Uses
antiinflammatory, glucocorticoid
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335-H319-H413 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 36-26 |
| WGK Germany | 3 |
| RTECS | SG1578000 |
| HS Code | 35040000 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 orally in mice, rats, and guinea pigs: >4 g/kg (Stenger) |






