BD0651532
2,4-Dichloro-1-(chloromethyl)benzene , 98% , 94-99-5
Synonym(s):
α,2,4-Trichlorotoluene
CAS NO.：94-99-5
Empirical Formula: C7H5Cl3
Molecular Weight: 195.47
MDL number: MFCD00000895
EINECS: 202-381-0
| Pack Size | Price | Stock | Quantity |
| 25g | RMB24.00 | In Stock |
|
| 100g | RMB39.20 | In Stock |
|
| 500g | RMB151.20 | In Stock |
|
| 1000g | RMB292.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -2.6 °C (lit.) |
| Boiling point: | 248 °C (lit.) |
| Density | 1.407 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Oily Liquid |
| color | Clear colorless to very light yellow |
| BRN | 387220 |
| InChI | InChI=1S/C7H5Cl3/c8-4-5-1-2-6(9)3-7(5)10/h1-3H,4H2 |
| InChIKey | IRSVDHPYXFLLDS-UHFFFAOYSA-N |
| SMILES | C1(CCl)=CC=C(Cl)C=C1Cl |
| LogP | 4.08 |
| CAS DataBase Reference | 94-99-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 2,4-dichloro-1-(chloromethyl)-(94-99-5) |
| EPA Substance Registry System | Benzene, 2,4-dichloro-1-(chloromethyl)- (94-99-5) |
Description and Uses
2,4-Dichlorobenzyl chloride was used as starting reagent for the synthesis of series of novel 1,2,4-triazolium derivatives.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| Hazard Codes | C,N |
| Risk Statements | 34-37-50/53-22 |
| Safety Statements | 26-36/37/39-45-61-60 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 19 |
| Hazard Note | Corrosive |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29036990 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
