A2485512
3-Chlorosalicylaldehyde , 97% , 1927-94-2
Synonym(s):
3-Chlorosalicylaldehyde
CAS NO.:1927-94-2
Empirical Formula: C7H5ClO2
Molecular Weight: 156.57
MDL number: MFCD04973581
EINECS: 626-834-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB92.00 | In Stock |
|
| 25g | RMB404.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 42-44°C |
| Boiling point: | 63°C/5mmHg(lit.) |
| Density | 1.404±0.06 g/cm3(Predicted) |
| Flash point: | 110 °C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Acetone (Slightly), Chloroform (Slightly), Dichloromethane (Slightly), DMSO(Slightly) |
| form | Solid |
| pka | 6.70±0.10(Predicted) |
| color | Pale Beige to Yellow |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C7H5ClO2/c8-6-3-1-2-5(4-9)7(6)10/h1-4,10H |
| InChIKey | DOHOPUBZLWVZMZ-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=CC(Cl)=C1O |
| CAS DataBase Reference | 1927-94-2(CAS DataBase Reference) |
Description and Uses
3-Chlorosalicylaldehyde (cas# 1927-94-2) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2913000090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





![Bis[3,4,6-trichloro-2-(pentyloxycarbonyl)phenyl] Oxalate](https://img.chemicalbook.com/CAS/GIF/30431-54-0.gif)
