A2486112
CNQX , ≥98% , 115066-14-3
Synonym(s):
6-Cyano-7-nitroquinoxaline-2,3-dione;6-Cyano-7-nitroquinoxaline-2,3-dione disodium salt hydrate;6-Cyano-7-nitroquinoxaline-2,3-dione, 6-Cyano-2,3-dihydroxy-7-nitro-quinoxaline;CNQX - CAS 115066-14-3 - Calbiochem;FG-9065
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB295.20 | In Stock |
|
| 25MG | RMB926.40 | In Stock |
|
| 100MG | RMB2959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 300 °C |
| Boiling point: | 374.31°C (rough estimate) |
| Density | 1.5507 (rough estimate) |
| refractive index | 1.6590 (estimate) |
| RTECS | VD1520000 |
| storage temp. | protect from light |
| solubility | H2O: 10 mg/mL |
| form | solid |
| pka | 8.16±0.20(Predicted) |
| color | orange to red |
| Water Solubility | H2O: >2mg/mL (warmed) |
| Stability: | Store Tightly Sealed at RT |
| InChI | 1S/C9H4N4O4/c10-3-4-1-5-6(2-7(4)13(16)17)12-9(15)8(14)11-5/h1-2H,(H,11,14)(H,12,15) |
| InChIKey | RPXVIAFEQBNEAX-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc2NC(=O)C(=O)Nc2cc1C#N |
| CAS DataBase Reference | 115066-14-3(CAS DataBase Reference) |
Description and Uses
CNQX disodium salt hydrate has been used as:
- as a competitive non-NMDA receptor antagonist and competitive AMPA/kainate receptor antagonist in neuronal cultures(110)
- as a glutamatergic blockers for measuring inhibitory postsynaptic currents in projection neurons(111)
- as a AMPA glutamate receptor antagonist prefrontal cortex neurons(112)
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
