A3302512
3,4-Diaminobenzonitrile , 97% , 17626-40-3
CAS NO.：17626-40-3
Empirical Formula: C7H7N3
Molecular Weight: 133.15
MDL number: MFCD00723901
EINECS: 629-100-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB51.20 | In Stock |
|
| 5G | RMB161.60 | In Stock |
|
| 25G | RMB604.80 | In Stock |
|
| 100G | RMB2232.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 144-148 °C |
| Boiling point: | 368.7±27.0 °C(Predicted) |
| Density | 1.24±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in dichloromethane, methanol and ethyl acetate. |
| pka | 2.35±0.10(Predicted) |
| form | Solid |
| color | Pale brown |
| λmax | 316nm(THF)(lit.) |
| Stability: | Store in freezer at -20°C |
| InChI | InChI=1S/C7H7N3/c8-4-5-1-2-6(9)7(10)3-5/h1-3H,9-10H2 |
| InChIKey | VWLLPPSBBHDXHK-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(N)C(N)=C1 |
| CAS DataBase Reference | 17626-40-3(CAS DataBase Reference) |
Description and Uses
A synthetic intermediate
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
