A2486212
(-)-Catechin Gallate , ≥98%(HPLC) , 130405-40-2
Synonym(s):
(−)-Catechin gallate;(2S,3R)-2-(3,4-Dihydroxyphenyl)-3,4-dihydro-1(2H)-benzopyran-3,5,7-triol 3-(3,4,5-trihydroxybenzoate)
| Pack Size | Price | Stock | Quantity |
| 1MG | RMB420.00 | In Stock |
|
| 5MG | RMB1037.60 | In Stock |
|
| 10mg | RMB1673.60 | In Stock |
|
| 25mg | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 248-251 °C (decomp) |
| Boiling point: | 861.7±65.0 °C(Predicted) |
| Density | 1.80±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Ethanol (Slightly) |
| form | Solid |
| pka | 7.75±0.25(Predicted) |
| color | Pale Yellow to Light Red |
| biological source | green tea |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | 1S/C22H18O10/c23-11-6-14(25)12-8-19(32-22(30)10-4-16(27)20(29)17(28)5-10)21(31-18(12)7-11)9-1-2-13(24)15(26)3-9/h1-7,19,21,23-29H,8H2/t19-,21+/m1/s1 |
| InChIKey | LSHVYAFMTMFKBA-CTNGQTDRSA-N |
| SMILES | Oc1cc(O)c2C[C@@H](OC(=O)c3cc(O)c(O)c(O)c3)[C@@H](Oc2c1)c4ccc(O)c(O)c4 |
| LogP | 2.670 (est) |
Description and Uses
A major component of green tea, is a dual phosphoinositide-3-kinase/mTOR inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




![[8]-Gingerol](https://img.chemicalbook.com/CAS/GIF/23513-08-8.gif)
