A2488512
5-Chloro-4-nitro-<I>o</I>-toluidine , 40% , 13852-51-2
Synonym(s):
2-Amino-4-chloro-5-nitrotoluene;5-Chloro-2-methyl-4-nitroaniline
CAS NO.:13852-51-2
Empirical Formula: C7H7ClN2O2
Molecular Weight: 186.6
MDL number: MFCD00043921
EINECS: 237-589-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB559.20 | In Stock |
|
| 25G | RMB1959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 164-167 °C (lit.) |
| Boiling point: | 375.2±37.0 °C(Predicted) |
| Density | 1.415±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | -0.13±0.14(Predicted) |
| form | solid |
| color | Light yellow to yellow |
| InChI | InChI=1S/C7H7ClN2O2/c1-4-2-7(10(11)12)5(8)3-6(4)9/h2-3H,9H2,1H3 |
| InChIKey | OKOSGBYZOWWAPH-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(Cl)=C([N+]([O-])=O)C=C1C |
| CAS DataBase Reference | 13852-51-2(CAS DataBase Reference) |
Description and Uses
5-Chloro-4-nitro-o-toluidine was used in the synthesis of 2-substituted 3,7,8-trichlorodibenzo-p-dioxins.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2921420090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





