A2492212
2-Chloro-5-fluorobenzoic Acid , ≥95.0%(T) , 2252-50-8
CAS NO.:2252-50-8
Empirical Formula: C7H4ClFO2
Molecular Weight: 174.56
MDL number: MFCD00156967
EINECS: 216-430-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB63.20 | In Stock |
|
| 25G | RMB207.20 | In Stock |
|
| 100G | RMB631.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 147-149°C |
| Boiling point: | 275.3±20.0 °C(Predicted) |
| Density | 1.477±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.54±0.25(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C7H4ClFO2/c8-6-2-1-4(9)3-5(6)7(10)11/h1-3H,(H,10,11) |
| InChIKey | MIZKCMSSYVUZKD-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(F)=CC=C1Cl |
| CAS DataBase Reference | 2252-50-8(CAS DataBase Reference) |
Description and Uses
2-Chloro-5-fluorobenzoic acid serves as a precursor for metal complexes, where it is converted to the sodium salt with sodium hydroxide and reacted with copper(II) sulfate pentahydrate in aqueous medium to form copper(II) bis(2-chloro-5-fluorobenzoate). The resulting 2-chloro-5-fluorobenzoate anion acts as a ligand coordinating to Cu(II) centers in complex chains stabilized by C–H···π interactions, and constitutes the counter-anion in the crystal structure of [Co(phen)₂CO₃]₂(C₇H₃O₂FCl)Cl·11H₂O[1][2].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 22-24/25-37-26 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163990 |





