A0815112
Amyl Chloroformate , ≥97.0%(GC) , 638-41-5
CAS NO.:638-41-5
Empirical Formula: C6H11ClO2
Molecular Weight: 150.6
MDL number: MFCD00058933
EINECS: 211-336-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB42.40 | In Stock |
|
| 100G | RMB95.20 | In Stock |
|
| 500G | RMB344.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 161 °C |
| Density | 1,04 g/cm3 |
| refractive index | 1.4181 |
| Flash point: | 53 °C |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform, Ethyl Acetate |
| form | Oil |
| color | Colourless |
| Water Solubility | 1.213g/L at 25℃ |
| InChI | InChI=1S/C6H11ClO2/c1-2-3-4-5-9-6(7)8/h2-5H2,1H3 |
| InChIKey | XHRRYUDVWPPWIP-UHFFFAOYSA-N |
| SMILES | C(Cl)(OCCCCC)=O |
| LogP | 3.03 |
| CAS DataBase Reference | 638-41-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Carbonochloridic acid, pentyl ester(638-41-5) |
| EPA Substance Registry System | Carbonochloridic acid, pentyl ester (638-41-5) |
Description and Uses
n-Pentyl Chloroformate is a chemical reagent used in the synthesis of intermediates for Capecitabine (C175650), an antineoplastic agent. As well as used for the synthesis of other pharmaceuticals such as dabigatran etexilate (D100150), a direct thrombin inhibitor.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H226-H331-H314 |
| Precautionary statements | P261-P271-P304+P340-P311-P321-P403+P233-P405-P501-P260-P264-P280-P301+P330+P331-P303+P361+P353-P363-P304+P340-P310-P321-P305+P351+P338-P405-P501 |
| Hazard Codes | C |
| Risk Statements | 10-23-34 |
| Safety Statements | 26-36-45-36/37/39 |
| RIDADR | 3277 |
| HazardClass | 6.1, 3, 8 |
| HS Code | 29159000 |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |









