A2521812
Cetyl chloroformate , >95.0%(T) , 26272-90-2
CAS NO.：26272-90-2
Empirical Formula: C17H33ClO2
Molecular Weight: 304.9
MDL number: MFCD00035954
EINECS: 247-578-2
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB23.20 | In Stock |
|
| 25ML | RMB42.40 | In Stock |
|
| 100ML | RMB100.80 | In Stock |
|
| 500ML | RMB393.60 | In Stock |
|
| 1L | RMB686.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 14 °C |
| Boiling point: | 367.1±11.0 °C(Predicted) |
| Density | 0.923 g/mL at 25 °C(lit.) |
| vapor pressure | 10Pa at 20℃ |
| refractive index | n |
| Flash point: | >230 °F |
| form | clear liquid |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C17H33ClO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-17(18)19/h2-16H2,1H3 |
| InChIKey | HOQUWXSARQBQCW-UHFFFAOYSA-N |
| SMILES | C(Cl)(OCCCCCCCCCCCCCCCC)=O |
| CAS DataBase Reference | 26272-90-2(CAS DataBase Reference) |
| EPA Substance Registry System | Carbonochloridic acid, hexadecyl ester (26272-90-2) |
Description and Uses
Cetyl chloroformate combined with modified cellulose nanocrystals contributes to improving the catalytic performance of Candida albicans lipase B (CALB).
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H290-H300+H310+H330-H314 |
| Precautionary statements | P234-P260-P262-P264-P270-P271-P280-P284-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P403+P233-P405-P406-P501 |
| Hazard Codes | C |
| Risk Statements | 34-43 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 6.1/8 |
| PackingGroup | II |
| HS Code | 29159000 |
