A5302812
Dodecyl Chloroformate , ≥90.0%(GC) , 24460-74-0
CAS NO.：24460-74-0
Empirical Formula: C13H25ClO2
Molecular Weight: 248.79
MDL number: MFCD00059483
EINECS: 246-272-6
| Pack Size | Price | Stock | Quantity |
| 25G | RMB44.80 | In Stock |
|
| 100G | RMB132.80 | In Stock |
|
| 500G | RMB434.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 168 °C / 20mmHg |
| Density | 0.922 g/mL at 25 °C(lit.) |
| vapor pressure | 1.33 mm Hg ( 20 °C) |
| refractive index | n |
| Flash point: | 230 °F |
| form | clear liquid |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C13H25ClO2/c1-2-3-4-5-6-7-8-9-10-11-12-16-13(14)15/h2-12H2,1H3 |
| InChIKey | AFPOMDNRTZLRMD-UHFFFAOYSA-N |
| SMILES | C(Cl)(OCCCCCCCCCCCC)=O |
| CAS DataBase Reference | 24460-74-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H290-H300+H310+H330-H314 |
| Precautionary statements | P234-P260-P262-P264-P270-P271-P280-P284-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P403+P233-P405-P406-P501 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29159000 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
